CAS 1956377-81-3 appears in our catalog under these names: (3-Bromo-2,5,6-trifluorophenyl)methanamine 2,2,2-trifluoroacetate, 95%, (3-Bromo-2,5,6-trifluorophenyl)methanamine 2,2,2-trifluoroacetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 25g.
(3-bromo-2,5,6-trifluorophenyl)methanamine;2,2,2-trifluoroacetic acid (CAS 1956377-81-3) is a chemical compound with the molecular formula C9H6BrF6NO2 and a molecular weight of 354.04 g/mol. IUPAC name: (3-bromo-2,5,6-trifluorophenyl)methanamine;2,2,2-trifluoroacetic acid. InChIKey: XPABTIZDAVJJQO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF6NO2 |
|---|---|
| Molecular weight | 354.04 g/mol |
| IUPAC name | (3-bromo-2,5,6-trifluorophenyl)methanamine;2,2,2-trifluoroacetic acid |
| InChIKey | XPABTIZDAVJJQO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)CN)F)F.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)