Products 1956379-15-9
CAS 1956379-15-9 is the registry number for 5-Chloro-1-(3,3,3-trifluoropropyl)-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-chloro-1-(3,3,3-trifluoropropyl)pyrazole-4-carboxylic acid (CAS 1956379-15-9) is a chemical compound with the molecular formula C7H6ClF3N2O2 and a molecular weight of 242.58 g/mol. IUPAC name: 5-chloro-1-(3,3,3-trifluoropropyl)pyrazole-4-carboxylic acid. InChIKey: RDBFDZVXTQUUBZ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF3N2O2 |
|---|---|
| Molecular weight | 242.58 g/mol |
| IUPAC name | 5-chloro-1-(3,3,3-trifluoropropyl)pyrazole-4-carboxylic acid |
| InChIKey | RDBFDZVXTQUUBZ-UHFFFAOYSA-N |
| SMILES | C1=NN(C(=C1C(=O)O)Cl)CCC(F)(F)F |
Computed by PubChem (NCBI)