CAS 1956382-38-9 is the registry number for 3-Bromo-5H,6H,7H-pyrrolo(3,4-b)pyridine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-bromo-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;dihydrochloride (CAS 1956382-38-9) is a chemical compound with the molecular formula C7H9BrCl2N2 and a molecular weight of 271.97 g/mol. IUPAC name: 3-bromo-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;dihydrochloride. InChIKey: YMFUAYBGAJPVIS-UHFFFAOYSA-N.
| Molecular formula | C7H9BrCl2N2 |
|---|---|
| Molecular weight | 271.97 g/mol |
| IUPAC name | 3-bromo-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine;dihydrochloride |
| InChIKey | YMFUAYBGAJPVIS-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)N=CC(=C2)Br.Cl.Cl |
Computed by PubChem (NCBI)