CAS 1956386-57-4 appears in our catalog under these names: 7-Bromo-6-methyl-1-((2-(trimethylsilyl)ethoxy)methyl)-1h-indazole, 95%, 7–Bromo–6–methyl–1–((2–(trimethylsilyl)ethoxy)methyl)–1H–indazole. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
2-[(7-bromo-6-methylindazol-1-yl)methoxy]ethyl-trimethylsilane (CAS 1956386-57-4) is a chemical compound with the molecular formula C14H21BrN2OSi and a molecular weight of 341.32 g/mol. IUPAC name: 2-[(7-bromo-6-methylindazol-1-yl)methoxy]ethyl-trimethylsilane. InChIKey: LTEFXOFWTSSNRJ-UHFFFAOYSA-N.
| Molecular formula | C14H21BrN2OSi |
|---|---|
| Molecular weight | 341.32 g/mol |
| IUPAC name | 2-[(7-bromo-6-methylindazol-1-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | LTEFXOFWTSSNRJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C=NN2COCC[Si](C)(C)C)Br |
Computed by PubChem (NCBI)