CAS 1956435-89-4 is the registry number for tert–butyl (R)–6–(trifluoromethyl)–2,7–diazaspiro(3·5)nonane–2–carboxylate. Offered by: GLPBio. Available pack sizes: 200mg.
Tert-butyl (6R)-6-(trifluoromethyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS 1956435-89-4) is a chemical compound with the molecular formula C13H21F3N2O2 and a molecular weight of 294.31 g/mol. IUPAC name: tert-butyl (6R)-6-(trifluoromethyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate. InChIKey: CNHFNGYCGGNRPX-SECBINFHSA-N.
| Molecular formula | C13H21F3N2O2 |
|---|---|
| Molecular weight | 294.31 g/mol |
| IUPAC name | tert-butyl (6R)-6-(trifluoromethyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| InChIKey | CNHFNGYCGGNRPX-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCN[C@H](C2)C(F)(F)F |
Computed by PubChem (NCBI)