CAS 1956437-95-8 appears in our catalog under these names: (R)-5-(Pyrrolidin-2-yl)-2H-tetrazole hydrochloride, 97%, 97%, 5-[(2R)-pyrrolidin-2-yl]-1H-1,2,3,4-tetrazole hydrochloride, 98%,RG. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500mg.
5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole;hydrochloride (CAS 1956437-95-8) is a chemical compound with the molecular formula C5H10ClN5 and a molecular weight of 175.62 g/mol. IUPAC name: 5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole;hydrochloride. InChIKey: XJSLLRDADMUYGJ-PGMHMLKASA-N.
| Molecular formula | C5H10ClN5 |
|---|---|
| Molecular weight | 175.62 g/mol |
| IUPAC name | 5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole;hydrochloride |
| InChIKey | XJSLLRDADMUYGJ-PGMHMLKASA-N |
| SMILES | C1C[C@@H](NC1)C2=NNN=N2.Cl |
Computed by PubChem (NCBI)