CAS 1957235-51-6 appears in our catalog under these names: 5-(2-Chloroacetamide) thalidomide 95%, 2-Chloro-N-(2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)acetamide, 95%, 95%, 5-(2-Chloroacetamide) thalidomide, 95.0%, 5-(2-Chloroacetamide) thalidomide, 95%. Offered by: Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 50 mg, 100 mg.
2-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]acetamide (CAS 1957235-51-6) is a chemical compound with the molecular formula C15H12ClN3O5 and a molecular weight of 349.72 g/mol. IUPAC name: 2-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]acetamide. InChIKey: OIDIVJNMVBHPAC-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3O5 |
|---|---|
| Molecular weight | 349.72 g/mol |
| IUPAC name | 2-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]acetamide |
| InChIKey | OIDIVJNMVBHPAC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)NC(=O)CCl |
Computed by PubChem (NCBI)