CAS 1957276-35-5 appears in our catalog under these names: SHP836, SHP836, 98%, SHP836, 99.39%, 99.39%, SHP836, 99.39%. Offered by: GLPBio, AmBeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 1g, 250mg, 10mg, 10mM (in 1ml dmso), 50mg, 1mg.
5-(2,3-dichlorophenyl)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyrimidin-4-amine (CAS 1957276-35-5) is a chemical compound with the molecular formula C16H19Cl2N5 and a molecular weight of 352.3 g/mol. IUPAC name: 5-(2,3-dichlorophenyl)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyrimidin-4-amine. InChIKey: SKFRRNOLFFQBQU-AOOOYVTPSA-N.
| Molecular formula | C16H19Cl2N5 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | 5-(2,3-dichlorophenyl)-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyrimidin-4-amine |
| InChIKey | SKFRRNOLFFQBQU-AOOOYVTPSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1)C)C2=NC=C(C(=N2)N)C3=C(C(=CC=C3)Cl)Cl |
Computed by PubChem (NCBI)