CAS 1958012-13-9 is the registry number for 4-Ethynyl-1,4-dihydro-6-methyl-1-[(4-methylphenyl)sulfonyl]-2H-3,1-benzoxazin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-ethynyl-6-methyl-1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one (CAS 1958012-13-9) is a chemical compound with the molecular formula C18H15NO4S and a molecular weight of 341.4 g/mol. IUPAC name: 4-ethynyl-6-methyl-1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one. InChIKey: BSUABDDMTRMZMW-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 4-ethynyl-6-methyl-1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one |
| InChIKey | BSUABDDMTRMZMW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C3=C(C=C(C=C3)C)C(OC2=O)C#C |
Computed by PubChem (NCBI)