Products 2241145-66-2
CAS 2241145-66-2 appears in our catalog under these names: Etoricoxib Impurity 47, Etoricoxib Impurity 45. Offered by: Chemat Brand. Available pack sizes: on request.
8-hydroxy-3-methyl-7-(4-methylsulfonylphenyl)isoquinoline-5-carbaldehyde (CAS 2241145-66-2) is a chemical compound with the molecular formula C18H15NO4S and a molecular weight of 341.4 g/mol. IUPAC name: 8-hydroxy-3-methyl-7-(4-methylsulfonylphenyl)isoquinoline-5-carbaldehyde. InChIKey: YFCZKLVGGIEKPP-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 8-hydroxy-3-methyl-7-(4-methylsulfonylphenyl)isoquinoline-5-carbaldehyde |
| InChIKey | YFCZKLVGGIEKPP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=N1)C(=C(C=C2C=O)C3=CC=C(C=C3)S(=O)(=O)C)O |
Computed by PubChem (NCBI)