Products 1958063-14-3

CAS 1958063-14-3 is the registry number for 5-Methyl-2-(tetrahydro-pyran-4-yl)-2h-pyrazole-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 5-methyl-2-(oxan-4-yl)pyrazole-3-carboxylate (CAS 1958063-14-3) is a chemical compound with the molecular formula C12H18N2O3 and a molecular weight of 238.28 g/mol. IUPAC name: ethyl 5-methyl-2-(oxan-4-yl)pyrazole-3-carboxylate. InChIKey: SSOWMYDVBHAITG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18N2O3
Molecular weight238.28 g/mol
IUPAC nameethyl 5-methyl-2-(oxan-4-yl)pyrazole-3-carboxylate
InChIKeySSOWMYDVBHAITG-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=NN1C2CCOCC2)C

Computed by PubChem (NCBI)