CAS 195875-84-4 appears in our catalog under these names: Tesofensine, Tesofensine, >95% (HPLC), Tesofensine, ≥98%, ≥98%, Tesofensine, 99.31%, Tesofensine (Standard). Offered by: Chemat Brand, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 25 mg, 5 mg.
(1R,2R,3S,5S)-3-(3,4-dichlorophenyl)-2-(ethoxymethyl)-8-methyl-8-azabicyclo[3.2.1]octane (CAS 195875-84-4) is a chemical compound with the molecular formula C17H23Cl2NO and a molecular weight of 328.3 g/mol. IUPAC name: (1R,2R,3S,5S)-3-(3,4-dichlorophenyl)-2-(ethoxymethyl)-8-methyl-8-azabicyclo[3.2.1]octane. InChIKey: VCVWXKKWDOJNIT-ZOMKSWQUSA-N.
| Molecular formula | C17H23Cl2NO |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | (1R,2R,3S,5S)-3-(3,4-dichlorophenyl)-2-(ethoxymethyl)-8-methyl-8-azabicyclo[3.2.1]octane |
| InChIKey | VCVWXKKWDOJNIT-ZOMKSWQUSA-N |
| SMILES | CCOC[C@H]1[C@H]2CC[C@H](N2C)C[C@@H]1C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)