CAS 195977-46-9 is the registry number for 5-Aminofluorescein diacetate. Offered by: Chemat. Available pack sizes: 10g, 1g, 250mg.
(6'-acetyloxy-5-amino-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate (CAS 195977-46-9) is a chemical compound with the molecular formula C24H17NO7 and a molecular weight of 431.4 g/mol. IUPAC name: (6'-acetyloxy-5-amino-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate. InChIKey: OJIRUUMPJJZGSG-UHFFFAOYSA-N.
| Molecular formula | C24H17NO7 |
|---|---|
| Molecular weight | 431.4 g/mol |
| IUPAC name | (6'-acetyloxy-5-amino-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| InChIKey | OJIRUUMPJJZGSG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)N)C(=O)O3)C5=C(O2)C=C(C=C5)OC(=O)C |
Computed by PubChem (NCBI)