CAS 1960487-55-1 is the registry number for Dimethyl 1,3-dimethylcyclopentane-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Dimethyl 1,3-dimethylcyclopentane-1,3-dicarboxylate (CAS 1960487-55-1) is a chemical compound with the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. IUPAC name: dimethyl 1,3-dimethylcyclopentane-1,3-dicarboxylate. InChIKey: APNPMNBRZOEDET-UHFFFAOYSA-N.
| Molecular formula | C11H18O4 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | dimethyl 1,3-dimethylcyclopentane-1,3-dicarboxylate |
| InChIKey | APNPMNBRZOEDET-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C1)(C)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)