CAS 19618-17-8 appears in our catalog under these names: 3,3'-Diiodoazoxybenzene, 95%, 3,3'-Diiodoazoxybenzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 500mg, 1000mg.
(3-iodophenyl)-(3-iodophenyl)imino-oxidoazanium (CAS 19618-17-8) is a chemical compound with the molecular formula C12H8I2N2O and a molecular weight of 450.01 g/mol. IUPAC name: (3-iodophenyl)-(3-iodophenyl)imino-oxidoazanium. InChIKey: GRWXCTMEYYYJQZ-UHFFFAOYSA-N.
| Molecular formula | C12H8I2N2O |
|---|---|
| Molecular weight | 450.01 g/mol |
| IUPAC name | (3-iodophenyl)-(3-iodophenyl)imino-oxidoazanium |
| InChIKey | GRWXCTMEYYYJQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)N=[N+](C2=CC(=CC=C2)I)[O-] |
Computed by PubChem (NCBI)