CAS 1962207-81-3 is the registry number for 2-Chloro-3',4'-difluoro-(1,1'-biphenyl)-4-carbaldehyde, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-chloro-4-(3,4-difluorophenyl)benzaldehyde (CAS 1962207-81-3) is a chemical compound with the molecular formula C13H7ClF2O and a molecular weight of 252.64 g/mol. IUPAC name: 3-chloro-4-(3,4-difluorophenyl)benzaldehyde. InChIKey: PFOHFRCTRVRKSP-UHFFFAOYSA-N.
| Molecular formula | C13H7ClF2O |
|---|---|
| Molecular weight | 252.64 g/mol |
| IUPAC name | 3-chloro-4-(3,4-difluorophenyl)benzaldehyde |
| InChIKey | PFOHFRCTRVRKSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)Cl)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)