CAS 19639-76-0 is the registry number for Pyridine-N-oxide-d5. Offered by: TRC. Available pack sizes: 500mg.
2,3,4,5,6-pentadeuterio-1-oxidopyridin-1-ium (CAS 19639-76-0) is a chemical compound with the molecular formula C5H5NO and a molecular weight of 100.13 g/mol. IUPAC name: 2,3,4,5,6-pentadeuterio-1-oxidopyridin-1-ium. InChIKey: ILVXOBCQQYKLDS-RALIUCGRSA-N.
| Molecular formula | C5H5NO |
|---|---|
| Molecular weight | 100.13 g/mol |
| IUPAC name | 2,3,4,5,6-pentadeuterio-1-oxidopyridin-1-ium |
| InChIKey | ILVXOBCQQYKLDS-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=[N+](C(=C1[2H])[2H])[O-])[2H])[2H] |
Computed by PubChem (NCBI)