CAS 1964503-36-3 appears in our catalog under these names: Nh-(peg2-t-butyl ester)2, 95%, NH–bis(PEG2–C2–Boc), NH-(peg2-t-butyl ester)2 98%, 4,7,13,16-Tetraoxa-10-azanonadecanedioic acid, 1,19-bis(1,1-dimethylethyl) ester, 95%+, 95%+, NH-bis(PEG2-C2-Boc), 98.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 50mg, 5g, 100 mg, 250 mg, 1 g.
Tert-butyl 3-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethylamino]ethoxy]ethoxy]propanoate (CAS 1964503-36-3) is a chemical compound with the molecular formula C22H43NO8 and a molecular weight of 449.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethylamino]ethoxy]ethoxy]propanoate. InChIKey: AFSYLABPPWEICE-UHFFFAOYSA-N.
| Molecular formula | C22H43NO8 |
|---|---|
| Molecular weight | 449.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethylamino]ethoxy]ethoxy]propanoate |
| InChIKey | AFSYLABPPWEICE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCNCCOCCOCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)