Products 1965316-82-8
CAS 1965316-82-8 appears in our catalog under these names: EP4 receptor antagonist 2, EP4 receptor antagonist 2, 99.01%. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 10 mg, 5 mg, 50 mg, 100 mg, 25 mg.
4-[4-cyano-2-[[(1'R,4S)-6-(propan-2-ylcarbamoyl)spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carbonyl]amino]phenyl]butanoic acid (CAS 1965316-82-8) is a chemical compound with the molecular formula C27H29N3O5 and a molecular weight of 475.5 g/mol. IUPAC name: 4-[4-cyano-2-[[(1'R,4S)-6-(propan-2-ylcarbamoyl)spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carbonyl]amino]phenyl]butanoic acid. InChIKey: QSRLBYGDVFRMPT-IDISGSTGSA-N.
| Molecular formula | C27H29N3O5 |
|---|---|
| Molecular weight | 475.5 g/mol |
| IUPAC name | 4-[4-cyano-2-[[(1'R,4S)-6-(propan-2-ylcarbamoyl)spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carbonyl]amino]phenyl]butanoic acid |
| InChIKey | QSRLBYGDVFRMPT-IDISGSTGSA-N |
| SMILES | CC(C)NC(=O)C1=CC2=C(C=C1)OCC[C@]23C[C@H]3C(=O)NC4=C(C=CC(=C4)C#N)CCCC(=O)O |
Computed by PubChem (NCBI)