CAS 196597-77-0 appears in our catalog under these names: 4,5-Dibromo-6,7-dihydro-1h-indeno[5,4-b]furan-8(2h)-one, 95%, Ramelteon Impurity K, Ramelteon Impurity 29, 4,5-Dibromo-1,2,6,7-tertahydro-8H-indeno(5,4-b)furan-8-one, 4,5–Dibromo–6,7–dihydro–1H–indeno(5,4–b)furan–8(2H)–one. Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, GLPBio. Available pack sizes: 1g, 250mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one (CAS 196597-77-0) is a chemical compound with the molecular formula C11H8Br2O2 and a molecular weight of 331.99 g/mol. IUPAC name: 4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one. InChIKey: KGVRTABDPHWMPF-UHFFFAOYSA-N.
| Molecular formula | C11H8Br2O2 |
|---|---|
| Molecular weight | 331.99 g/mol |
| IUPAC name | 4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one |
| InChIKey | KGVRTABDPHWMPF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C3=C2CCO3)Br)Br |
Computed by PubChem (NCBI)