CAS 196597-78-1 appears in our catalog under these names: 1,2,6,7-Tetrahydro-8h-indeno[5,4-b]furan-8-one, 95%, Ramelteon Impurity 5, 1,2,6,7-Tetrahydro-8H-indeno(5,4-b)furan-8-one, 6,7–Dihydro–1H–indeno(5,4–b)furan–8(2H)–one, 6,7-Dihydro-1H-indeno[5,4-b]furan-8(2H)-one, >98.0%(GC). Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, TCI. Available pack sizes: 10g, 250mg, 25g, 1g, 5g, on request, 100mg, 25mg.
1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one (CAS 196597-78-1) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one. InChIKey: ZZUIZMWFNOKNLN-UHFFFAOYSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one |
| InChIKey | ZZUIZMWFNOKNLN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC3=C2CCO3 |
Computed by PubChem (NCBI)