CAS 19662-59-0 appears in our catalog under these names: Copper (ii) methacrylate, 95%, Copper(II) Methacrylate Hydrate, Tech·, Copper(II) methacrylate, tech. , Copperiimethacrylate,monohydrate. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 5g, 25g, 1g, 250mg.
Copper bis(2-methylprop-2-enoate) (CAS 19662-59-0) is a chemical compound with the molecular formula C8H10CuO4 and a molecular weight of 233.71 g/mol. IUPAC name: copper bis(2-methylprop-2-enoate). InChIKey: VZWHXRLOECMQDD-UHFFFAOYSA-L.
| Molecular formula | C8H10CuO4 |
|---|---|
| Molecular weight | 233.71 g/mol |
| IUPAC name | copper bis(2-methylprop-2-enoate) |
| InChIKey | VZWHXRLOECMQDD-UHFFFAOYSA-L |
| SMILES | CC(=C)C(=O)[O-].CC(=C)C(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)