Products 1966933-85-6
CAS 1966933-85-6 appears in our catalog under these names: KDM2B–IN–4, KDM2B-IN-4, 99.61%, KDM2B-IN-4, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mM(in 1ml dmso), 100 mg, 25 mg, 5 mg, 10mM/1mL, 50 mg.
2-[6-[(3S,4S)-1-cyclobutyl-4-methylpiperidine-3-carbonyl]-2-methoxynaphthalen-1-yl]acetonitrile (CAS 1966933-85-6) is a chemical compound with the molecular formula C24H28N2O2 and a molecular weight of 376.5 g/mol. IUPAC name: 2-[6-[(3S,4S)-1-cyclobutyl-4-methylpiperidine-3-carbonyl]-2-methoxynaphthalen-1-yl]acetonitrile. InChIKey: BJDGGDWQTYWFQS-KSFYIVLOSA-N.
| Molecular formula | C24H28N2O2 |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | 2-[6-[(3S,4S)-1-cyclobutyl-4-methylpiperidine-3-carbonyl]-2-methoxynaphthalen-1-yl]acetonitrile |
| InChIKey | BJDGGDWQTYWFQS-KSFYIVLOSA-N |
| SMILES | C[C@H]1CCN(C[C@H]1C(=O)C2=CC3=C(C=C2)C(=C(C=C3)OC)CC#N)C4CCC4 |
Computed by PubChem (NCBI)
Synonyms:
orb1688476