CAS 196700-86-4 is the registry number for 3-Chloro-n-(2,4-dimethylphenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N-(2,4-dimethylphenyl)benzamide (CAS 196700-86-4) is a chemical compound with the molecular formula C15H14ClNO and a molecular weight of 259.73 g/mol. IUPAC name: 3-chloro-N-(2,4-dimethylphenyl)benzamide. InChIKey: QELIKGWXXVXBOT-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | 3-chloro-N-(2,4-dimethylphenyl)benzamide |
| InChIKey | QELIKGWXXVXBOT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C2=CC(=CC=C2)Cl)C |
Computed by PubChem (NCBI)