Products 1969288-55-8
CAS 1969288-55-8 is the registry number for rac-tert-Butyl (3R,4S)-4-(1,5-dimethyl-1H-pyrazol-4-yl)pyrrolidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 25mg, 0,25g.
Tert-butyl (3S,4R)-4-(1,5-dimethylpyrazol-4-yl)pyrrolidine-3-carboxylate (CAS 1969288-55-8) is a chemical compound with the molecular formula C14H23N3O2 and a molecular weight of 265.35 g/mol. IUPAC name: tert-butyl (3S,4R)-4-(1,5-dimethylpyrazol-4-yl)pyrrolidine-3-carboxylate. InChIKey: ANSXENIQCWFTMP-NWDGAFQWSA-N.
| Molecular formula | C14H23N3O2 |
|---|---|
| Molecular weight | 265.35 g/mol |
| IUPAC name | tert-butyl (3S,4R)-4-(1,5-dimethylpyrazol-4-yl)pyrrolidine-3-carboxylate |
| InChIKey | ANSXENIQCWFTMP-NWDGAFQWSA-N |
| SMILES | CC1=C(C=NN1C)[C@@H]2CNC[C@H]2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)