CAS 196930-46-8 appears in our catalog under these names: (4R)-2-Phenylthiazolidine-4-carboxylic acid, 97%, (4R)-2-Phenylthiazolidine-4-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100mg, 10g, 1g, 5g, 250mg.
(4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid (CAS 196930-46-8) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: AZDYQBFYMBALBY-IENPIDJESA-N.
| Molecular formula | C10H11NO2S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | AZDYQBFYMBALBY-IENPIDJESA-N |
| SMILES | C1[C@H](NC(S1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)