Products 197144-93-7
CAS 197144-93-7 is the registry number for (R,Z)-3-(5-(Dimethylamino)-4-methylpent-2-en-3-yl)phenol Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
3-[(Z,4R)-5-(dimethylamino)-4-methylpent-2-en-3-yl]phenol;hydrochloride (CAS 197144-93-7) is a chemical compound with the molecular formula C14H22ClNO and a molecular weight of 255.78 g/mol. IUPAC name: 3-[(Z,4R)-5-(dimethylamino)-4-methylpent-2-en-3-yl]phenol;hydrochloride. InChIKey: TZOOYBCJSXMJPM-UOOGNVTLSA-N.
| Molecular formula | C14H22ClNO |
|---|---|
| Molecular weight | 255.78 g/mol |
| IUPAC name | 3-[(Z,4R)-5-(dimethylamino)-4-methylpent-2-en-3-yl]phenol;hydrochloride |
| InChIKey | TZOOYBCJSXMJPM-UOOGNVTLSA-N |
| SMILES | C/C=C(\C1=CC(=CC=C1)O)/[C@@H](C)CN(C)C.Cl |
Computed by PubChem (NCBI)