CAS 19716-67-7 appears in our catalog under these names: Pseudocoptisine, Berberine Impurity 10. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5,7,18,20-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.017,21]tetracosa-1(24),2,4(8),9,13,15,17(21),22-octaene (CAS 19716-67-7) is a chemical compound with the molecular formula C19H14NO4+ and a molecular weight of 320.3 g/mol. IUPAC name: 5,7,18,20-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.017,21]tetracosa-1(24),2,4(8),9,13,15,17(21),22-octaene. InChIKey: IDEMWTMCJLNBDH-UHFFFAOYSA-N.
| Molecular formula | C19H14NO4+ |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | 5,7,18,20-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.017,21]tetracosa-1(24),2,4(8),9,13,15,17(21),22-octaene |
| InChIKey | IDEMWTMCJLNBDH-UHFFFAOYSA-N |
| SMILES | C1C[N+]2=CC3=CC4=C(C=C3C=C2C5=CC6=C(C=C51)OCO6)OCO4 |
Computed by PubChem (NCBI)