Products 197230-76-5
CAS 197230-76-5 is the registry number for 5,7-Diiodo-1-oxaspiro(2.5)octa-4,7-dien-6-one. Offered by: TRC. Available pack sizes: 10g.
5,7-diiodo-1-oxaspiro[2.5]octa-4,7-dien-6-one (CAS 197230-76-5) is a chemical compound with the molecular formula C7H4I2O2 and a molecular weight of 373.91 g/mol. IUPAC name: 5,7-diiodo-1-oxaspiro[2.5]octa-4,7-dien-6-one. InChIKey: CJQMKKCOQTWKRO-UHFFFAOYSA-N.
| Molecular formula | C7H4I2O2 |
|---|---|
| Molecular weight | 373.91 g/mol |
| IUPAC name | 5,7-diiodo-1-oxaspiro[2.5]octa-4,7-dien-6-one |
| InChIKey | CJQMKKCOQTWKRO-UHFFFAOYSA-N |
| SMILES | C1C2(O1)C=C(C(=O)C(=C2)I)I |
Computed by PubChem (NCBI)