Products 197234-17-6

CAS 197234-17-6 is the registry number for Ethyl 5-bromo-3,3-dimethyl-4-oxopentanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 5-bromo-3,3-dimethyl-4-oxopentanoate (CAS 197234-17-6) is a chemical compound with the molecular formula C9H15BrO3 and a molecular weight of 251.12 g/mol. IUPAC name: ethyl 5-bromo-3,3-dimethyl-4-oxopentanoate. InChIKey: PYLPLZQXKKWAFF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15BrO3
Molecular weight251.12 g/mol
IUPAC nameethyl 5-bromo-3,3-dimethyl-4-oxopentanoate
InChIKeyPYLPLZQXKKWAFF-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C)(C)C(=O)CBr

Computed by PubChem (NCBI)