CAS 197244-91-0 is the registry number for (1,1-Dioxidobenzo[b]thiophen-2-yl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
(1,1-dioxo-1-benzothiophen-2-yl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate (CAS 197244-91-0) is a chemical compound with the molecular formula C14H11NO7S and a molecular weight of 337.31 g/mol. IUPAC name: (1,1-dioxo-1-benzothiophen-2-yl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: XBVMGLSMCWWRLS-UHFFFAOYSA-N.
| Molecular formula | C14H11NO7S |
|---|---|
| Molecular weight | 337.31 g/mol |
| IUPAC name | (1,1-dioxo-1-benzothiophen-2-yl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | XBVMGLSMCWWRLS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)OCC2=CC3=CC=CC=C3S2(=O)=O |
Computed by PubChem (NCBI)