CAS 197245-19-5 is the registry number for (((1,1-Dioxidobenzo[b]thiophen-2-yl)methoxy)carbonyl)-L-phenylalanine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[(1,1-dioxo-1-benzothiophen-2-yl)methoxycarbonylamino]-3-phenylpropanoic acid (CAS 197245-19-5) is a chemical compound with the molecular formula C19H17NO6S and a molecular weight of 387.4 g/mol. IUPAC name: (2S)-2-[(1,1-dioxo-1-benzothiophen-2-yl)methoxycarbonylamino]-3-phenylpropanoic acid. InChIKey: DWLKZXPISLVRER-INIZCTEOSA-N.
| Molecular formula | C19H17NO6S |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | (2S)-2-[(1,1-dioxo-1-benzothiophen-2-yl)methoxycarbonylamino]-3-phenylpropanoic acid |
| InChIKey | DWLKZXPISLVRER-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2=CC3=CC=CC=C3S2(=O)=O |
Computed by PubChem (NCBI)