CAS 197311-76-5 appears in our catalog under these names: Sodium (2-cyanophenyl)methanesulfonate, 96%, Sodium (2–cyanophenyl)methanesulfonate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g.
Sodium (2-cyanophenyl)methanesulfonate (CAS 197311-76-5) is a chemical compound with the molecular formula C8H6NNaO3S and a molecular weight of 219.19 g/mol. IUPAC name: sodium (2-cyanophenyl)methanesulfonate. InChIKey: GEDNNRCEBYWLKO-UHFFFAOYSA-M.
| Molecular formula | C8H6NNaO3S |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | sodium (2-cyanophenyl)methanesulfonate |
| InChIKey | GEDNNRCEBYWLKO-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)[O-])C#N.[Na+] |
Computed by PubChem (NCBI)