CAS 1973408-86-4 is the registry number for tert-Butyl (3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl)carbamate, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]carbamate (CAS 1973408-86-4) is a chemical compound with the molecular formula C20H27ClN2O3 and a molecular weight of 378.9 g/mol. IUPAC name: tert-butyl N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]carbamate. InChIKey: PNWZFPYVCGIHSI-UHFFFAOYSA-N.
| Molecular formula | C20H27ClN2O3 |
|---|---|
| Molecular weight | 378.9 g/mol |
| IUPAC name | tert-butyl N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]carbamate |
| InChIKey | PNWZFPYVCGIHSI-UHFFFAOYSA-N |
| SMILES | CC1(C(C(C1OC2=CC(=C(C=C2)C#N)Cl)(C)C)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)