Products 1809144-50-0

CAS 1809144-50-0 is the registry number for Benzyl (4-(4-(2-aminoethyl)phenoxy)butyl)carbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-[4-(2-aminoethyl)phenoxy]butyl N-benzylcarbamate;hydrochloride (CAS 1809144-50-0) is a chemical compound with the molecular formula C20H27ClN2O3 and a molecular weight of 378.9 g/mol. IUPAC name: 4-[4-(2-aminoethyl)phenoxy]butyl N-benzylcarbamate;hydrochloride. InChIKey: QKKLFRMLWPECEP-UHFFFAOYSA-N.

Identity
Molecular formulaC20H27ClN2O3
Molecular weight378.9 g/mol
IUPAC name4-[4-(2-aminoethyl)phenoxy]butyl N-benzylcarbamate;hydrochloride
InChIKeyQKKLFRMLWPECEP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CNC(=O)OCCCCOC2=CC=C(C=C2)CCN.Cl

Computed by PubChem (NCBI)