CAS 1973494-17-5 is the registry number for NRL-1049 (dihydrochloride), 99.20%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 10 mg, 100 mg, 25 mg, 50 mg.
(1R)-1-(1-isoquinolin-5-ylsulfonylpiperidin-4-yl)ethanamine;dihydrochloride (CAS 1973494-17-5) is a chemical compound with the molecular formula C16H23Cl2N3O2S and a molecular weight of 392.3 g/mol. IUPAC name: (1R)-1-(1-isoquinolin-5-ylsulfonylpiperidin-4-yl)ethanamine;dihydrochloride. InChIKey: ZGHFCJWOBKWTQK-CURYUGHLSA-N.
| Molecular formula | C16H23Cl2N3O2S |
|---|---|
| Molecular weight | 392.3 g/mol |
| IUPAC name | (1R)-1-(1-isoquinolin-5-ylsulfonylpiperidin-4-yl)ethanamine;dihydrochloride |
| InChIKey | ZGHFCJWOBKWTQK-CURYUGHLSA-N |
| SMILES | C[C@H](C1CCN(CC1)S(=O)(=O)C2=CC=CC3=C2C=CN=C3)N.Cl.Cl |
Computed by PubChem (NCBI)