CAS 1973503-47-7 appears in our catalog under these names: 2-Amino-2-(6-fluoropyridin-2-yl)ethanol hydrochloride, 95%, 2–Amino–2–(6–fluoropyridin–2–yl)ethanol hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-amino-2-(6-fluoro-2-pyridinyl)ethanol;hydrochloride (CAS 1973503-47-7) is a chemical compound with the molecular formula C7H10ClFN2O and a molecular weight of 192.62 g/mol. IUPAC name: 2-amino-2-(6-fluoro-2-pyridinyl)ethanol;hydrochloride. InChIKey: WQGQOSBNVRPDDY-UHFFFAOYSA-N.
| Molecular formula | C7H10ClFN2O |
|---|---|
| Molecular weight | 192.62 g/mol |
| IUPAC name | 2-amino-2-(6-fluoro-2-pyridinyl)ethanol;hydrochloride |
| InChIKey | WQGQOSBNVRPDDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)F)C(CO)N.Cl |
Computed by PubChem (NCBI)