CAS 1973503-49-9 appears in our catalog under these names: 5,7–Dibromo–6–methyl–1–((2–(trimethylsilyl)ethoxy)methyl)–1H–indazole, 5,7-Dibromo-6-methyl-1-((2-(trimethylsilyl)ethoxy)methyl)-1H-indazole, 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 10g, 5g, 1g, 25g, 100g.
2-[(5,7-dibromo-6-methylindazol-1-yl)methoxy]ethyl-trimethylsilane (CAS 1973503-49-9) is a chemical compound with the molecular formula C14H20Br2N2OSi and a molecular weight of 420.21 g/mol. IUPAC name: 2-[(5,7-dibromo-6-methylindazol-1-yl)methoxy]ethyl-trimethylsilane. InChIKey: XUGKFCOKYIOFNE-UHFFFAOYSA-N.
| Molecular formula | C14H20Br2N2OSi |
|---|---|
| Molecular weight | 420.21 g/mol |
| IUPAC name | 2-[(5,7-dibromo-6-methylindazol-1-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | XUGKFCOKYIOFNE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C=NN(C2=C1Br)COCC[Si](C)(C)C)Br |
Computed by PubChem (NCBI)