CAS 19741-14-1 appears in our catalog under these names: Methotrexate EP Impurity E, DAMPA, >95% (HPLC), 4-(((2,4-Diaminopteridin-6-yl)methyl)methylamino)benzoic Acid (4-Amino-N10-methylpteroic Acid, APA), Methotrexate metabolite/ 95.28% (existing batch purity), 4-(((2,4-Diamino-6-pteridinyl)methyl)methylamino)benzoic acid. Offered by: Chemat Brand, TRC, Mikromol, TargetMol, Biosynth. Available pack sizes: on request, 500mg, 50mg, 25mg, 100mg, 0,25g, 0,1g, 0,5g.
4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid (CAS 19741-14-1) is a chemical compound with the molecular formula C15H15N7O2 and a molecular weight of 325.33 g/mol. IUPAC name: 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid. InChIKey: LWCXZSDKANNOAR-UHFFFAOYSA-N.
| Molecular formula | C15H15N7O2 |
|---|---|
| Molecular weight | 325.33 g/mol |
| IUPAC name | 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid |
| InChIKey | LWCXZSDKANNOAR-UHFFFAOYSA-N |
| SMILES | CN(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)