CAS 197431-02-0 appears in our catalog under these names: Dronedarone EP Impurity A HCl (N-Desbutyl Dronedarone HCl), Desbutyl Dronedarone Hydrochloride, >95% (HPLC), N–Desbutyl Dronedarone (hydrochloride), Desbutyl dronedarone hydrochloride, Debutyldronedarone (hydrochloride), 98.73%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 1mg, 10mg, 5mg, 50mg, 100mg.
N-[2-butyl-3-[4-[3-(butylamino)propoxy]benzoyl]-1-benzofuran-5-yl]methanesulfonamide;hydrochloride (CAS 197431-02-0) is a chemical compound with the molecular formula C27H37ClN2O5S and a molecular weight of 537.1 g/mol. IUPAC name: N-[2-butyl-3-[4-[3-(butylamino)propoxy]benzoyl]-1-benzofuran-5-yl]methanesulfonamide;hydrochloride. InChIKey: ZDXBTJLIQYUYSZ-UHFFFAOYSA-N.
| Molecular formula | C27H37ClN2O5S |
|---|---|
| Molecular weight | 537.1 g/mol |
| IUPAC name | N-[2-butyl-3-[4-[3-(butylamino)propoxy]benzoyl]-1-benzofuran-5-yl]methanesulfonamide;hydrochloride |
| InChIKey | ZDXBTJLIQYUYSZ-UHFFFAOYSA-N |
| SMILES | CCCCC1=C(C2=C(O1)C=CC(=C2)NS(=O)(=O)C)C(=O)C3=CC=C(C=C3)OCCCNCCCC.Cl |
Computed by PubChem (NCBI)