CAS 197438-73-6 is the registry number for BMS-347070. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3Z)-3-[(4-bromophenyl)-(4-methylsulfonylphenyl)methylidene]oxolan-2-one (CAS 197438-73-6) is a chemical compound with the molecular formula C18H15BrO4S and a molecular weight of 407.3 g/mol. IUPAC name: (3Z)-3-[(4-bromophenyl)-(4-methylsulfonylphenyl)methylidene]oxolan-2-one. InChIKey: KOWIZHDULJSRPT-WUKNDPDISA-N.
| Molecular formula | C18H15BrO4S |
|---|---|
| Molecular weight | 407.3 g/mol |
| IUPAC name | (3Z)-3-[(4-bromophenyl)-(4-methylsulfonylphenyl)methylidene]oxolan-2-one |
| InChIKey | KOWIZHDULJSRPT-WUKNDPDISA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)/C(=C/2\CCOC2=O)/C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)