CAS 197514-90-2 appears in our catalog under these names: 5-(1-Adamantyl)-1,3,4-oxadiazole-2-thiol, 95%, 5-(Adamantan-1-yl)-1,3,4-oxadiazole-2-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-(1-adamantyl)-3H-1,3,4-oxadiazole-2-thione (CAS 197514-90-2) is a chemical compound with the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. IUPAC name: 5-(1-adamantyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: QLRSPGHQEPSBOC-UHFFFAOYSA-N.
| Molecular formula | C12H16N2OS |
|---|---|
| Molecular weight | 236.34 g/mol |
| IUPAC name | 5-(1-adamantyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | QLRSPGHQEPSBOC-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=NNC(=S)O4 |
Computed by PubChem (NCBI)