Products 19762-23-3

CAS 19762-23-3 is the registry number for Methyl 5-ethynyl-1-methyl-1H-pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 5-ethynyl-1-methylpyrazole-3-carboxylate (CAS 19762-23-3) is a chemical compound with the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. IUPAC name: methyl 5-ethynyl-1-methylpyrazole-3-carboxylate. InChIKey: UPMVPVFHKVLIBS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8N2O2
Molecular weight164.16 g/mol
IUPAC namemethyl 5-ethynyl-1-methylpyrazole-3-carboxylate
InChIKeyUPMVPVFHKVLIBS-UHFFFAOYSA-N
SMILESCN1C(=CC(=N1)C(=O)OC)C#C

Computed by PubChem (NCBI)