CAS 1977-00-0 appears in our catalog under these names: Sodium 2-[[3-(trifluoromethyl)phenyl]amino]benzoate, 95%, Sodium 2-((3-(trifluoromethyl)phenyl)amino)benzoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 1000mg, 500mg, 2000mg, 5000mg.
Sodium 2-[3-(trifluoromethyl)anilino]benzoate (CAS 1977-00-0) is a chemical compound with the molecular formula C14H9F3NNaO2 and a molecular weight of 303.21 g/mol. IUPAC name: sodium 2-[3-(trifluoromethyl)anilino]benzoate. InChIKey: PBUGSBBHKCUSBT-UHFFFAOYSA-M.
| Molecular formula | C14H9F3NNaO2 |
|---|---|
| Molecular weight | 303.21 g/mol |
| IUPAC name | sodium 2-[3-(trifluoromethyl)anilino]benzoate |
| InChIKey | PBUGSBBHKCUSBT-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])NC2=CC=CC(=C2)C(F)(F)F.[Na+] |
Computed by PubChem (NCBI)