CAS 1977-07-7 appears in our catalog under these names: 11-(4-Methyl-1-piperazinyl)-5h-dibenzo(b,e)(1,4)diazepine, 95%, Dechloroclozapine, Deschloroclozapine, Dopamine serotonin antagonist–1, 11-(4-Methylpiperazin-1-yl)-5H-dibenzo[b,e][1,4]diazepine, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, on request, 10mg, 5mg, 10mM (in 1ml dmso), 50mg, 250mg, 1mg.
6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine (CAS 1977-07-7) is a chemical compound with the molecular formula C18H20N4 and a molecular weight of 292.4 g/mol. IUPAC name: 6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine. InChIKey: VQHITFFJBFOMBG-UHFFFAOYSA-N.
| Molecular formula | C18H20N4 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine |
| InChIKey | VQHITFFJBFOMBG-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=CC=CC=C3NC4=CC=CC=C42 |
Computed by PubChem (NCBI)