CAS 197720-41-5 is the registry number for 2-Deoxy-2-fluoro-D-galactose 3,4,6-Triacetate. Offered by: TRC. Available pack sizes: 500mg.
[(2R,3S,4S,5R)-3,4-diacetyloxy-5-fluoro-6-hydroxyoxan-2-yl]methyl acetate (CAS 197720-41-5) is a chemical compound with the molecular formula C12H17FO8 and a molecular weight of 308.26 g/mol. IUPAC name: [(2R,3S,4S,5R)-3,4-diacetyloxy-5-fluoro-6-hydroxyoxan-2-yl]methyl acetate. InChIKey: WHLQUICFVHKZPZ-OZRWLHRGSA-N.
| Molecular formula | C12H17FO8 |
|---|---|
| Molecular weight | 308.26 g/mol |
| IUPAC name | [(2R,3S,4S,5R)-3,4-diacetyloxy-5-fluoro-6-hydroxyoxan-2-yl]methyl acetate |
| InChIKey | WHLQUICFVHKZPZ-OZRWLHRGSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H](C(O1)O)F)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)