CAS 1977506-84-5 is the registry number for 2,2,2-trifluoro-1-(3-methoxy-5-methylphenyl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,2,2-trifluoro-1-(3-methoxy-5-methylphenyl)ethanone (CAS 1977506-84-5) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-methoxy-5-methylphenyl)ethanone. InChIKey: SEBRCOUXWNCDHP-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-methoxy-5-methylphenyl)ethanone |
| InChIKey | SEBRCOUXWNCDHP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OC)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)