Products 1977557-93-9
CAS 1977557-93-9 appears in our catalog under these names: SC209 intermediate-1, 96.0%, SC209 intermediate-1, SC209 intermediate-1, 95%. Offered by: MedChemExpress, Chemat, Fluorochem. Available pack sizes: 1 mg, 25 mg, 5 mg, 10 mg, 1mg, 5mg, 50mg.
(2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[3-(prop-2-enoxycarbonylamino)phenyl]butanoic acid (CAS 1977557-93-9) is a chemical compound with the molecular formula C21H30N2O6 and a molecular weight of 406.5 g/mol. IUPAC name: (2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[3-(prop-2-enoxycarbonylamino)phenyl]butanoic acid. InChIKey: WZSKLNHEJZJMLY-MRXNPFEDSA-N.
| Molecular formula | C21H30N2O6 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | (2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[3-(prop-2-enoxycarbonylamino)phenyl]butanoic acid |
| InChIKey | WZSKLNHEJZJMLY-MRXNPFEDSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@H](C(=O)O)C(C)(C)C1=CC(=CC=C1)NC(=O)OCC=C |
Computed by PubChem (NCBI)
Synonyms:
orb2283412