CAS 19777-68-5 appears in our catalog under these names: (S)-2,3-Diaminopropanoic acid dihydrochloride, 95%, (S)-2,3-Diaminopropanoic acid dihydrochloride, 98+%, (S)-2,3-Diaminopropanoic acid dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 50g.
(2S)-2,3-diaminopropanoic acid;dihydrochloride (CAS 19777-68-5) is a chemical compound with the molecular formula C3H10Cl2N2O2 and a molecular weight of 177.03 g/mol. IUPAC name: (2S)-2,3-diaminopropanoic acid;dihydrochloride. InChIKey: TYEJBZICQABABM-JIZZDEOASA-N.
| Molecular formula | C3H10Cl2N2O2 |
|---|---|
| Molecular weight | 177.03 g/mol |
| IUPAC name | (2S)-2,3-diaminopropanoic acid;dihydrochloride |
| InChIKey | TYEJBZICQABABM-JIZZDEOASA-N |
| SMILES | C([C@@H](C(=O)O)N)N.Cl.Cl |
Computed by PubChem (NCBI)