Products 197777-66-5
CAS 197777-66-5 is the registry number for Fluorescein-diphosphat (diammonium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Azane;(3-oxo-6'-phosphonooxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) dihydrogen phosphate (CAS 197777-66-5) is a chemical compound with the molecular formula C20H20N2O11P2 and a molecular weight of 526.3 g/mol. IUPAC name: azane;(3-oxo-6'-phosphonooxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) dihydrogen phosphate. InChIKey: RLVSMISHQDPIJA-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O11P2 |
|---|---|
| Molecular weight | 526.3 g/mol |
| IUPAC name | azane;(3-oxo-6'-phosphonooxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) dihydrogen phosphate |
| InChIKey | RLVSMISHQDPIJA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)OP(=O)(O)O)OC5=C3C=CC(=C5)OP(=O)(O)O.N.N |
Computed by PubChem (NCBI)
Synonyms:
Fluorescein-diphosphat diammonium salt